About tert-butyl formate;4,4-difluoropiperidine
tert-butyl formate;4,4-difluoropiperidine (PubChem CID 174784442) has the molecular formula C10H19F2NO2
and a molecular weight of 223.26 g/mol. Its IUPAC name is tert-butyl formate;4,4-difluoropiperidine.
Molecular Properties
| Compound Name | tert-butyl formate;4,4-difluoropiperidine |
| PubChem CID | 174784442 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | tert-butyl formate;4,4-difluoropiperidine |
| SMILES | CC(C)(C)OC=O.FC1(F)CCNCC1 |
| InChI | InChI=1S/C5H9F2N.C5H10O2/c6-5(7)1-3-8-4-2-5;1-5(2,3)7-4-6/h8H,1-4H2;4H,1-3H3 |
| InChIKey | BSMPTPQGXVCPON-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;4,4-difluoropiperidine?
The IUPAC name of tert-butyl formate;4,4-difluoropiperidine (CID 174784442) is tert-butyl formate;4,4-difluoropiperidine.
What is the SMILES notation for tert-butyl formate;4,4-difluoropiperidine?
The canonical SMILES for tert-butyl formate;4,4-difluoropiperidine is CC(C)(C)OC=O.FC1(F)CCNCC1.
What is the InChIKey of tert-butyl formate;4,4-difluoropiperidine?
The InChIKey is BSMPTPQGXVCPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2N.C5H10O2/c6-5(7)1-3-8-4-2-5;1-5(2,3)7-4-6/h8H,1-4H2;4H,1-3H3.
What are the key properties of tert-butyl formate;4,4-difluoropiperidine?
tert-butyl formate;4,4-difluoropiperidine has a molecular weight of 223.26 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;4,4-difluoropiperidine is sourced from PubChem (CID 174784442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).