C11H21F2NO3 — CID 174758740
tert-butyl formate;[(2S)-5,5-difluoropiperidin-2-yl]methanol (PubChem CID 174758740) has the molecular formula C11H21F2NO3 and a molecular weight of 253.29 g/mol. Its IUPAC name is tert-butyl formate;[(2S)-5,5-difluoropiperidin-2-yl]methanol.
| Compound Name | tert-butyl formate;[(2S)-5,5-difluoropiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 174758740 |
| Molecular Formula | C11H21F2NO3 |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | tert-butyl formate;[(2S)-5,5-difluoropiperidin-2-yl]methanol |
| SMILES | CC(C)(C)OC=O.OC[C@@H]1CCC(F)(F)CN1 |
| InChI | InChI=1S/C6H11F2NO.C5H10O2/c7-6(8)2-1-5(3-10)9-4-6;1-5(2,3)7-4-6/h5,9-10H,1-4H2;4H,1-3H3/t5-;/m0./s1 |
| InChIKey | DBQLBHQOGRRDMH-JEDNCBNOSA-N |
| XLogP | 1.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|