C6H12F2N2 — CID 171530972
(5,5-difluoropiperidin-2-yl)methanamine (PubChem CID 171530972) has the molecular formula C6H12F2N2 and a molecular weight of 150.17 g/mol. Its IUPAC name is (5,5-difluoropiperidin-2-yl)methanamine.
| Compound Name | (5,5-difluoropiperidin-2-yl)methanamine |
|---|---|
| PubChem CID | 171530972 |
| Molecular Formula | C6H12F2N2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (5,5-difluoropiperidin-2-yl)methanamine |
| SMILES | NCC1CCC(F)(F)CN1 |
| InChI | InChI=1S/C6H12F2N2/c7-6(8)2-1-5(3-9)10-4-6/h5,10H,1-4,9H2 |
| InChIKey | RFJGHOZIQKCFLZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |