About (2S)-5,5-difluoropiperidine-2-carboxylic acid
(2S)-5,5-difluoropiperidine-2-carboxylic acid (PubChem CID 45082546) has the molecular formula C6H9F2NO2
and a molecular weight of 165.14 g/mol. Its IUPAC name is (2S)-5,5-difluoropiperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-5,5-difluoropiperidine-2-carboxylic acid |
| PubChem CID | 45082546 |
| Molecular Formula | C6H9F2NO2 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (2S)-5,5-difluoropiperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCC(F)(F)CN1 |
| InChI | InChI=1S/C6H9F2NO2/c7-6(8)2-1-4(5(10)11)9-3-6/h4,9H,1-3H2,(H,10,11)/t4-/m0/s1 |
| InChIKey | BFZRDTSYFQNDDT-BYPYZUCNSA-N |
| XLogP | 0.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-5,5-difluoropiperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5,5-difluoropiperidine-2-carboxylic acid?
The IUPAC name of (2S)-5,5-difluoropiperidine-2-carboxylic acid (CID 45082546) is (2S)-5,5-difluoropiperidine-2-carboxylic acid.
What is the SMILES notation for (2S)-5,5-difluoropiperidine-2-carboxylic acid?
The canonical SMILES for (2S)-5,5-difluoropiperidine-2-carboxylic acid is O=C(O)[C@@H]1CCC(F)(F)CN1.
What is the InChIKey of (2S)-5,5-difluoropiperidine-2-carboxylic acid?
The InChIKey is BFZRDTSYFQNDDT-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H9F2NO2/c7-6(8)2-1-4(5(10)11)9-3-6/h4,9H,1-3H2,(H,10,11)/t4-/m0/s1.
What are the key properties of (2S)-5,5-difluoropiperidine-2-carboxylic acid?
(2S)-5,5-difluoropiperidine-2-carboxylic acid has a molecular weight of 165.14 g/mol, XLogP of 0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5,5-difluoropiperidine-2-carboxylic acid is sourced from PubChem (CID 45082546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).