C7H14F2N2O — CID 97300367
[(2R,5S)-5-(difluoromethoxy)piperidin-2-yl]methanamine (PubChem CID 97300367) has the molecular formula C7H14F2N2O and a molecular weight of 180.20 g/mol. Its IUPAC name is [(2R,5S)-5-(difluoromethoxy)piperidin-2-yl]methanamine.
| Compound Name | [(2R,5S)-5-(difluoromethoxy)piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 97300367 |
| Molecular Formula | C7H14F2N2O |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | [(2R,5S)-5-(difluoromethoxy)piperidin-2-yl]methanamine |
| SMILES | NC[C@H]1CC[C@H](OC(F)F)CN1 |
| InChI | InChI=1S/C7H14F2N2O/c8-7(9)12-6-2-1-5(3-10)11-4-6/h5-7,11H,1-4,10H2/t5-,6+/m1/s1 |
| InChIKey | OZOGSOXHHHWEHA-RITPCOANSA-N |
| XLogP | 0.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |