C13H20F4N2O5 — CID 175141092
bis[(3R,5S)-5-(difluoromethoxymethyl)pyrrolidin-3-yl] carbonate (PubChem CID 175141092) has the molecular formula C13H20F4N2O5 and a molecular weight of 360.30 g/mol. Its IUPAC name is bis[(3R,5S)-5-(difluoromethoxymethyl)pyrrolidin-3-yl] carbonate.
| Compound Name | bis[(3R,5S)-5-(difluoromethoxymethyl)pyrrolidin-3-yl] carbonate |
|---|---|
| PubChem CID | 175141092 |
| Molecular Formula | C13H20F4N2O5 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | bis[(3R,5S)-5-(difluoromethoxymethyl)pyrrolidin-3-yl] carbonate |
| SMILES | O=C(O[C@H]1CN[C@H](COC(F)F)C1)O[C@H]1CN[C@H](COC(F)F)C1 |
| InChI | InChI=1S/C13H20F4N2O5/c14-11(15)21-5-7-1-9(3-18-7)23-13(20)24-10-2-8(19-4-10)6-22-12(16)17/h7-12,18-19H,1-6H2/t7-,8-,9+,10+/m0/s1 |
| InChIKey | NYFTYILCPXDDSR-AXTSPUMRSA-N |
| XLogP | 1.08 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |