C7H15N3O3 — CID 145222763
2-amino-N-[[(4R)-4-hydroxypyrrolidin-2-yl]methoxy]acetamide (PubChem CID 145222763) has the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-amino-N-[[(4R)-4-hydroxypyrrolidin-2-yl]methoxy]acetamide.
| Compound Name | 2-amino-N-[[(4R)-4-hydroxypyrrolidin-2-yl]methoxy]acetamide |
|---|---|
| PubChem CID | 145222763 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 2-amino-N-[[(4R)-4-hydroxypyrrolidin-2-yl]methoxy]acetamide |
| SMILES | NCC(=O)NOCC1C[C@@H](O)CN1 |
| InChI | InChI=1S/C7H15N3O3/c8-2-7(12)10-13-4-5-1-6(11)3-9-5/h5-6,9,11H,1-4,8H2,(H,10,12)/t5?,6-/m1/s1 |
| InChIKey | VVTYQEQVTNIFBB-PRJDIBJQSA-N |
| XLogP | -2.28 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|