C6H11NO3 — CID 66585003
2-[(2R,4S)-4-hydroxypyrrolidin-2-yl]acetic acid (PubChem CID 66585003) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-[(2R,4S)-4-hydroxypyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2R,4S)-4-hydroxypyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 66585003 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-[(2R,4S)-4-hydroxypyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1C[C@H](O)CN1 |
| InChI | InChI=1S/C6H11NO3/c8-5-1-4(7-3-5)2-6(9)10/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5+/m1/s1 |
| InChIKey | HEUWVFJLYQNYMK-UHNVWZDZSA-N |
| XLogP | -0.82 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |