About (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride
(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 11205991) has the molecular formula C5H10ClNO3
and a molecular weight of 167.59 g/mol. Its IUPAC name is (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride.
Analyze (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride?
The IUPAC name of (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride (CID 11205991) is (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride.
What is the SMILES notation for (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride?
The canonical SMILES for (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride is Cl.O=C(O)[C@@H]1C[C@@H](O)CN1.
What is the InChIKey of (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride?
The InChIKey is YEJFFQAGTXBSTI-HJXLNUONSA-N. The full InChI is InChI=1S/C5H9NO3.ClH/c7-3-1-4(5(8)9)6-2-3;/h3-4,6-7H,1-2H2,(H,8,9);1H/t3-,4+;/m1./s1.
What are the key properties of (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride?
(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride has a molecular weight of 167.59 g/mol, XLogP of -0.78, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 11205991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).