C6H12ClNO3 — CID 146013112
(2R,5S)-5-hydroxypiperidine-2-carboxylic acid;hydrochloride (PubChem CID 146013112) has the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. Its IUPAC name is (2R,5S)-5-hydroxypiperidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2R,5S)-5-hydroxypiperidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 146013112 |
| Molecular Formula | C6H12ClNO3 |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | (2R,5S)-5-hydroxypiperidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@H]1CC[C@H](O)CN1 |
| InChI | InChI=1S/C6H11NO3.ClH/c8-4-1-2-5(6(9)10)7-3-4;/h4-5,7-8H,1-3H2,(H,9,10);1H/t4-,5+;/m0./s1 |
| InChIKey | ZWHYCCWEJZJLHW-UYXJWNHNSA-N |
| XLogP | -0.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |