C5H13NO4Si — CID 131716757
(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydroxysilane (PubChem CID 131716757) has the molecular formula C5H13NO4Si and a molecular weight of 179.25 g/mol. Its IUPAC name is (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydroxysilane.
| Compound Name | (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydroxysilane |
|---|---|
| PubChem CID | 131716757 |
| Molecular Formula | C5H13NO4Si |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;hydroxysilane |
| SMILES | O=C(O)[C@@H]1C[C@@H](O)CN1.O[SiH3] |
| InChI | InChI=1S/C5H9NO3.H4OSi/c7-3-1-4(5(8)9)6-2-3;1-2/h3-4,6-7H,1-2H2,(H,8,9);1H,2H3/t3-,4+;/m1./s1 |
| InChIKey | XSXNHVZHUZDAHF-HJXLNUONSA-N |
| XLogP | -2.95 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|