C9H14N2O3 — CID 172843797
(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;1H-pyrrole (PubChem CID 172843797) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;1H-pyrrole.
| Compound Name | (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;1H-pyrrole |
|---|---|
| PubChem CID | 172843797 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid;1H-pyrrole |
| SMILES | O=C(O)[C@@H]1C[C@@H](O)CN1.c1cc[nH]c1 |
| InChI | InChI=1S/C5H9NO3.C4H5N/c7-3-1-4(5(8)9)6-2-3;1-2-4-5-3-1/h3-4,6-7H,1-2H2,(H,8,9);1-5H/t3-,4+;/m1./s1 |
| InChIKey | XDKQRLJQGJOYSX-HJXLNUONSA-N |
| XLogP | -0.19 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |