C17H25NO5 — CID 68625775
ethyl 4-phenylbutanoate;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 68625775) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl 4-phenylbutanoate;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | ethyl 4-phenylbutanoate;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 68625775 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | ethyl 4-phenylbutanoate;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)CCCc1ccccc1.O=C(O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C12H16O2.C5H9NO3/c1-2-14-12(13)10-6-9-11-7-4-3-5-8-11;7-3-1-4(5(8)9)6-2-3/h3-5,7-8H,2,6,9-10H2,1H3;3-4,6-7H,1-2H2,(H,8,9)/t;3-,4+/m.1/s1 |
| InChIKey | BAGZMVSUWMCPAN-OOLPFSOCSA-N |
| XLogP | 1.37 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |