C16H26N4O4 — CID 175113737
4,4-diamino-N-benzylbutanamide;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 175113737) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4,4-diamino-N-benzylbutanamide;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 4,4-diamino-N-benzylbutanamide;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175113737 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4,4-diamino-N-benzylbutanamide;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | NC(N)CCC(=O)NCc1ccccc1.O=C(O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C11H17N3O.C5H9NO3/c12-10(13)6-7-11(15)14-8-9-4-2-1-3-5-9;7-3-1-4(5(8)9)6-2-3/h1-5,10H,6-8,12-13H2,(H,14,15);3-4,6-7H,1-2H2,(H,8,9)/t;3-,4+/m.1/s1 |
| InChIKey | GUXVZADHYKZTPA-OOLPFSOCSA-N |
| XLogP | -0.88 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|