C12H15BrN2O2 — CID 121231100
(2S,4R)-N-[(4-bromophenyl)methyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 121231100) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is (2S,4R)-N-[(4-bromophenyl)methyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(4-bromophenyl)methyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 121231100 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (2S,4R)-N-[(4-bromophenyl)methyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccc(Br)cc1)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C12H15BrN2O2/c13-9-3-1-8(2-4-9)6-15-12(17)11-5-10(16)7-14-11/h1-4,10-11,14,16H,5-7H2,(H,15,17)/t10-,11+/m1/s1 |
| InChIKey | WOSQIJYMIZZWNX-MNOVXSKESA-N |
| XLogP | 0.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |