C11H13F2NO — CID 132965820
N-benzyl-4,4-difluorobutanamide (PubChem CID 132965820) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is N-benzyl-4,4-difluorobutanamide.
| Compound Name | N-benzyl-4,4-difluorobutanamide |
|---|---|
| PubChem CID | 132965820 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-benzyl-4,4-difluorobutanamide |
| SMILES | O=C(CCC(F)F)NCc1ccccc1 |
| InChI | InChI=1S/C11H13F2NO/c12-10(13)6-7-11(15)14-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15) |
| InChIKey | WOHWGCCEPTYAEH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |