C5H11N3O2 — CID 45084250
(2S,4R)-4-hydroxypyrrolidine-2-carbohydrazide (PubChem CID 45084250) has the molecular formula C5H11N3O2 and a molecular weight of 145.16 g/mol. Its IUPAC name is (2S,4R)-4-hydroxypyrrolidine-2-carbohydrazide.
| Compound Name | (2S,4R)-4-hydroxypyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 45084250 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (2S,4R)-4-hydroxypyrrolidine-2-carbohydrazide |
| SMILES | NNC(=O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C5H11N3O2/c6-8-5(10)4-1-3(9)2-7-4/h3-4,7,9H,1-2,6H2,(H,8,10)/t3-,4+/m1/s1 |
| InChIKey | DQPBFVWXINZXKL-DMTCNVIQSA-N |
| XLogP | -2.30 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|