C7H14N2O2 — CID 28943534
(2R,4S)-N-ethyl-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 28943534) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is (2R,4S)-N-ethyl-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-ethyl-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 28943534 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (2R,4S)-N-ethyl-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1C[C@H](O)CN1 |
| InChI | InChI=1S/C7H14N2O2/c1-2-8-7(11)6-3-5(10)4-9-6/h5-6,9-10H,2-4H2,1H3,(H,8,11)/t5-,6+/m0/s1 |
| InChIKey | JVRAWLCPDUXNKF-NTSWFWBYSA-N |
| XLogP | -1.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |