C8H14N2O5 — CID 140615237
ethylcarbamoyl (2S,4S)-4-hydroxypyrrolidine-2-carboperoxoate (PubChem CID 140615237) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is ethylcarbamoyl (2S,4S)-4-hydroxypyrrolidine-2-carboperoxoate.
| Compound Name | ethylcarbamoyl (2S,4S)-4-hydroxypyrrolidine-2-carboperoxoate |
|---|---|
| PubChem CID | 140615237 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | ethylcarbamoyl (2S,4S)-4-hydroxypyrrolidine-2-carboperoxoate |
| SMILES | CCNC(=O)OOC(=O)[C@@H]1C[C@H](O)CN1 |
| InChI | InChI=1S/C8H14N2O5/c1-2-9-8(13)15-14-7(12)6-3-5(11)4-10-6/h5-6,10-11H,2-4H2,1H3,(H,9,13)/t5-,6-/m0/s1 |
| InChIKey | DCRHCWZQUJBEAR-WDSKDSINSA-N |
| XLogP | -1.09 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|