C13H26ClNO3 — CID 70134324
octyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride (PubChem CID 70134324) has the molecular formula C13H26ClNO3 and a molecular weight of 279.81 g/mol. Its IUPAC name is octyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | octyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70134324 |
| Molecular Formula | C13H26ClNO3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | octyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride |
| SMILES | CCCCCCCCOC(=O)[C@@H]1C[C@@H](O)CN1.Cl |
| InChI | InChI=1S/C13H25NO3.ClH/c1-2-3-4-5-6-7-8-17-13(16)12-9-11(15)10-14-12;/h11-12,14-15H,2-10H2,1H3;1H/t11-,12+;/m1./s1 |
| InChIKey | DVRQLXUODHTIBJ-LYCTWNKOSA-N |
| XLogP | 2.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|