C47H91NO6 — CID 176885105
[8-(9-heptadecan-9-yloxyheptadecan-9-yloxy)-8-oxooctyl] (2S)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 176885105) has the molecular formula C47H91NO6 and a molecular weight of 766.25 g/mol. Its IUPAC name is [8-(9-heptadecan-9-yloxyheptadecan-9-yloxy)-8-oxooctyl] (2S)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | [8-(9-heptadecan-9-yloxyheptadecan-9-yloxy)-8-oxooctyl] (2S)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 176885105 |
| Molecular Formula | C47H91NO6 |
| Molecular Weight | 766.25 g/mol |
| Exact Mass | 765.68 |
| IUPAC Name | [8-(9-heptadecan-9-yloxyheptadecan-9-yloxy)-8-oxooctyl] (2S)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(CCCCCCCC)(CCCCCCCC)OC(=O)CCCCCCCOC(=O)[C@@H]1CC(O)CN1 |
| InChI | InChI=1S/C47H91NO6/c1-5-9-13-17-22-28-34-43(35-29-23-18-14-10-6-2)53-47(37-31-25-19-15-11-7-3,38-32-26-20-16-12-8-4)54-45(50)36-30-24-21-27-33-39-52-46(51)44-40-42(49)41-48-44/h42-44,48-49H,5-41H2,1-4H3/t42?,44-/m0/s1 |
| InChIKey | ZHJRJDPCEDZZLF-KANPIIBWSA-N |
| XLogP | 13.22 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.25 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|