C31H57NO7 — CID 169203793
1-O-tert-butyl 2-O-(8-oxo-8-tridecan-7-yloxyoctyl) (2S)-4-hydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 169203793) has the molecular formula C31H57NO7 and a molecular weight of 555.80 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(8-oxo-8-tridecan-7-yloxyoctyl) (2S)-4-hydroxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(8-oxo-8-tridecan-7-yloxyoctyl) (2S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169203793 |
| Molecular Formula | C31H57NO7 |
| Molecular Weight | 555.80 g/mol |
| Exact Mass | 555.41 |
| IUPAC Name | 1-O-tert-butyl 2-O-(8-oxo-8-tridecan-7-yloxyoctyl) (2S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCCCC(CCCCCC)OC(=O)CCCCCCCOC(=O)[C@@H]1CC(O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H57NO7/c1-6-8-10-15-19-26(20-16-11-9-7-2)38-28(34)21-17-13-12-14-18-22-37-29(35)27-23-25(33)24-32(27)30(36)39-31(3,4)5/h25-27,33H,6-24H2,1-5H3/t25?,27-/m0/s1 |
| InChIKey | VSPFGELDZDTWIQ-GPNIZQGCSA-N |
| XLogP | 7.09 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.80 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|