C31H59NO5 — CID 175933580
(8-heptadecan-9-yloxy-8-oxooctyl) (2S,5S)-5-hydroxypiperidine-2-carboxylate (PubChem CID 175933580) has the molecular formula C31H59NO5 and a molecular weight of 525.82 g/mol. Its IUPAC name is (8-heptadecan-9-yloxy-8-oxooctyl) (2S,5S)-5-hydroxypiperidine-2-carboxylate.
| Compound Name | (8-heptadecan-9-yloxy-8-oxooctyl) (2S,5S)-5-hydroxypiperidine-2-carboxylate |
|---|---|
| PubChem CID | 175933580 |
| Molecular Formula | C31H59NO5 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 525.44 |
| IUPAC Name | (8-heptadecan-9-yloxy-8-oxooctyl) (2S,5S)-5-hydroxypiperidine-2-carboxylate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOC(=O)[C@@H]1CC[C@H](O)CN1 |
| InChI | InChI=1S/C31H59NO5/c1-3-5-7-9-12-16-20-28(21-17-13-10-8-6-4-2)37-30(34)22-18-14-11-15-19-25-36-31(35)29-24-23-27(33)26-32-29/h27-29,32-33H,3-26H2,1-2H3/t27-,29-/m0/s1 |
| InChIKey | HPPVWOLACLHSKW-YTMVLYRLSA-N |
| XLogP | 7.40 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|