C10H19NO3 — CID 63842504
pentyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 63842504) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is pentyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | pentyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 63842504 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | pentyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCCCCOC(=O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C10H19NO3/c1-2-3-4-5-14-10(13)9-6-8(12)7-11-9/h8-9,11-12H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | YJFHJWQIBJDKEC-BDAKNGLRSA-N |
| XLogP | 0.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|