C10H19NO5 — CID 104563509
2-(2-methoxyethoxy)ethyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 104563509) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | 2-(2-methoxyethoxy)ethyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 104563509 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | COCCOCCOC(=O)[C@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C10H19NO5/c1-14-2-3-15-4-5-16-10(13)9-6-8(12)7-11-9/h8-9,11-12H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | QSRDYIKAVFDZRD-RKDXNWHRSA-N |
| XLogP | -1.08 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|