C11H21NO4 — CID 106448237
2-(2-methylpropoxy)ethyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 106448237) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | 2-(2-methylpropoxy)ethyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 106448237 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CC(C)COCCOC(=O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C11H21NO4/c1-8(2)7-15-3-4-16-11(14)10-5-9(13)6-12-10/h8-10,12-13H,3-7H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | JCFKPQAQUCENPG-ZJUUUORDSA-N |
| XLogP | -0.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|