C10H19NO4 — CID 78999645
2-propan-2-yloxyethyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 78999645) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 78999645 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-propan-2-yloxyethyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CC(C)OCCOC(=O)[C@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C10H19NO4/c1-7(2)14-3-4-15-10(13)9-5-8(12)6-11-9/h7-9,11-12H,3-6H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | HHUZKKXKVJJTIN-RKDXNWHRSA-N |
| XLogP | -0.32 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|