C5H10N2O3 — CID 159655489
amino (2S,4R)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 159655489) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is amino (2S,4R)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | amino (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 159655489 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | amino (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | NOC(=O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C5H10N2O3/c6-10-5(9)4-1-3(8)2-7-4/h3-4,7-8H,1-2,6H2/t3-,4+/m1/s1 |
| InChIKey | DHUYJMMZSPLDNP-DMTCNVIQSA-N |
| XLogP | -1.87 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|