C9H15N3O6 — CID 175925544
4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate (PubChem CID 175925544) has the molecular formula C9H15N3O6 and a molecular weight of 261.23 g/mol. Its IUPAC name is 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate.
| Compound Name | 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate |
|---|---|
| PubChem CID | 175925544 |
| Molecular Formula | C9H15N3O6 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate |
| SMILES | NOC(=O)C[C@H](N)C(=O)OC(=O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C9H15N3O6/c10-5(2-7(14)18-11)8(15)17-9(16)6-1-4(13)3-12-6/h4-6,12-13H,1-3,10-11H2/t4-,5+,6+/m1/s1 |
| InChIKey | FQNJHRXLOVRGLP-SRQIZXRXSA-N |
| XLogP | -3.09 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|