About 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate
4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate (PubChem CID 175925544) has the molecular formula C9H15N3O6
and a molecular weight of 261.23 g/mol. Its IUPAC name is 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate.
Molecular Properties
| Compound Name | 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate |
| PubChem CID | 175925544 |
| Molecular Formula | C9H15N3O6 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate |
| SMILES | NOC(=O)C[C@H](N)C(=O)OC(=O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C9H15N3O6/c10-5(2-7(14)18-11)8(15)17-9(16)6-1-4(13)3-12-6/h4-6,12-13H,1-3,10-11H2/t4-,5+,6+/m1/s1 |
| InChIKey | FQNJHRXLOVRGLP-SRQIZXRXSA-N |
| XLogP | -3.09 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate?
The IUPAC name of 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate (CID 175925544) is 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate.
What is the SMILES notation for 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate?
The canonical SMILES for 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate is NOC(=O)C[C@H](N)C(=O)OC(=O)[C@@H]1C[C@@H](O)CN1.
What is the InChIKey of 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate?
The InChIKey is FQNJHRXLOVRGLP-SRQIZXRXSA-N. The full InChI is InChI=1S/C9H15N3O6/c10-5(2-7(14)18-11)8(15)17-9(16)6-1-4(13)3-12-6/h4-6,12-13H,1-3,10-11H2/t4-,5+,6+/m1/s1.
What are the key properties of 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate?
4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate has a molecular weight of 261.23 g/mol, XLogP of -3.09, 4 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-amino 1-O-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl] (2S)-2-aminobutanedioate is sourced from PubChem (CID 175925544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).