C7H11NO4 — CID 72698583
acetyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 72698583) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is acetyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | acetyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 72698583 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | acetyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CC(=O)OC(=O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C7H11NO4/c1-4(9)12-7(11)6-2-5(10)3-8-6/h5-6,8,10H,2-3H2,1H3/t5-,6+/m1/s1 |
| InChIKey | YZKHMSKXDSGOLV-RITPCOANSA-N |
| XLogP | -1.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|