C5H11ClN2O2 — CID 68860939
(2S)-4-hydroxypyrrolidine-2-carboxamide;hydrochloride (PubChem CID 68860939) has the molecular formula C5H11ClN2O2 and a molecular weight of 166.61 g/mol. Its IUPAC name is (2S)-4-hydroxypyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-4-hydroxypyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68860939 |
| Molecular Formula | C5H11ClN2O2 |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | (2S)-4-hydroxypyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)[C@@H]1CC(O)CN1 |
| InChI | InChI=1S/C5H10N2O2.ClH/c6-5(9)4-1-3(8)2-7-4;/h3-4,7-8H,1-2H2,(H2,6,9);1H/t3?,4-;/m0./s1 |
| InChIKey | OICPVUAPEGFLSK-LXNQBTANSA-N |
| XLogP | -1.38 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |