C10H16CuN2O6 — CID 25216296
copper bis((2S,4R)-4-hydroxypyrrolidine-2-carboxylate) (PubChem CID 25216296) has the molecular formula C10H16CuN2O6 and a molecular weight of 323.79 g/mol. Its IUPAC name is copper bis((2S,4R)-4-hydroxypyrrolidine-2-carboxylate).
| Compound Name | copper bis((2S,4R)-4-hydroxypyrrolidine-2-carboxylate) |
|---|---|
| PubChem CID | 25216296 |
| Molecular Formula | C10H16CuN2O6 |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | copper bis((2S,4R)-4-hydroxypyrrolidine-2-carboxylate) |
| SMILES | O=C([O-])[C@@H]1C[C@@H](O)CN1.O=C([O-])[C@@H]1C[C@@H](O)CN1.[Cu+2] |
| InChI | InChI=1S/2C5H9NO3.Cu/c2*7-3-1-4(5(8)9)6-2-3;/h2*3-4,6-7H,1-2H2,(H,8,9);/q;;+2/p-2/t2*3-,4+;/m11./s1 |
| InChIKey | NNAIRDOXDASAIH-OGXRZFKVSA-L |
| XLogP | -5.08 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | -5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |