C10H20N2O5 — CID 19098789
4-hydroxypyrrolidine-2-carboxylic acid;2-(trimethylazaniumyl)acetate (PubChem CID 19098789) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-hydroxypyrrolidine-2-carboxylic acid;2-(trimethylazaniumyl)acetate.
| Compound Name | 4-hydroxypyrrolidine-2-carboxylic acid;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 19098789 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-hydroxypyrrolidine-2-carboxylic acid;2-(trimethylazaniumyl)acetate |
| SMILES | C[N+](C)(C)CC(=O)[O-].O=C(O)C1CC(O)CN1 |
| InChI | InChI=1S/C5H9NO3.C5H11NO2/c7-3-1-4(5(8)9)6-2-3;1-6(2,3)4-5(7)8/h3-4,6-7H,1-2H2,(H,8,9);4H2,1-3H3 |
| InChIKey | SYGFTXNBIYXKTA-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|