About 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid
2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 67068644) has the molecular formula C7H14N2O5
and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid.
Analyze 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid?
The IUPAC name of 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (CID 67068644) is 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid.
What is the SMILES notation for 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid?
The canonical SMILES for 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid is NCC(=O)O.O=C(O)[C@@H]1C[C@@H](O)CN1.
What is the InChIKey of 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid?
The InChIKey is DDRAYWXTTWQAEA-HJXLNUONSA-N. The full InChI is InChI=1S/C5H9NO3.C2H5NO2/c7-3-1-4(5(8)9)6-2-3;3-1-2(4)5/h3-4,6-7H,1-2H2,(H,8,9);1,3H2,(H,4,5)/t3-,4+;/m1./s1.
What are the key properties of 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid?
2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid has a molecular weight of 206.20 g/mol, XLogP of -2.18, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid is sourced from PubChem (CID 67068644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).