About pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate
pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 57077496) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate |
| PubChem CID | 57077496 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | O=C(ON1CCCC1)[C@@H]1CC(O)CN1 |
| InChI | InChI=1S/C9H16N2O3/c12-7-5-8(10-6-7)9(13)14-11-3-1-2-4-11/h7-8,10,12H,1-6H2/t7?,8-/m0/s1 |
| InChIKey | VECACRJIJSIAJS-MQWKRIRWSA-N |
| XLogP | -0.74 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate?
The IUPAC name of pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate (CID 57077496) is pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate.
What is the SMILES notation for pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate?
The canonical SMILES for pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate is O=C(ON1CCCC1)[C@@H]1CC(O)CN1.
What is the InChIKey of pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate?
The InChIKey is VECACRJIJSIAJS-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H16N2O3/c12-7-5-8(10-6-7)9(13)14-11-3-1-2-4-11/h7-8,10,12H,1-6H2/t7?,8-/m0/s1.
What are the key properties of pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate?
pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate has a molecular weight of 200.24 g/mol, XLogP of -0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl (2S)-4-hydroxypyrrolidine-2-carboxylate is sourced from PubChem (CID 57077496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).