About pyrrolidin-1-yl cyclopropanecarboxylate
pyrrolidin-1-yl cyclopropanecarboxylate (PubChem CID 154313391) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is pyrrolidin-1-yl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | pyrrolidin-1-yl cyclopropanecarboxylate |
| PubChem CID | 154313391 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | pyrrolidin-1-yl cyclopropanecarboxylate |
| SMILES | O=C(ON1CCCC1)C1CC1 |
| InChI | InChI=1S/C8H13NO2/c10-8(7-3-4-7)11-9-5-1-2-6-9/h7H,1-6H2 |
| InChIKey | XZBJGDCVHHLNTN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidin-1-yl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl cyclopropanecarboxylate?
The IUPAC name of pyrrolidin-1-yl cyclopropanecarboxylate (CID 154313391) is pyrrolidin-1-yl cyclopropanecarboxylate.
What is the SMILES notation for pyrrolidin-1-yl cyclopropanecarboxylate?
The canonical SMILES for pyrrolidin-1-yl cyclopropanecarboxylate is O=C(ON1CCCC1)C1CC1.
What is the InChIKey of pyrrolidin-1-yl cyclopropanecarboxylate?
The InChIKey is XZBJGDCVHHLNTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c10-8(7-3-4-7)11-9-5-1-2-6-9/h7H,1-6H2.
What are the key properties of pyrrolidin-1-yl cyclopropanecarboxylate?
pyrrolidin-1-yl cyclopropanecarboxylate has a molecular weight of 155.20 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl cyclopropanecarboxylate is sourced from PubChem (CID 154313391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).