About pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride
pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride (PubChem CID 174730416) has the molecular formula C8H14ClNO2
and a molecular weight of 191.66 g/mol. Its IUPAC name is pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride.
Molecular Properties
| Compound Name | pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride |
| PubChem CID | 174730416 |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride |
| SMILES | Cl.O=C(ON1CCCC1)C1CC1 |
| InChI | InChI=1S/C8H13NO2.ClH/c10-8(7-3-4-7)11-9-5-1-2-6-9;/h7H,1-6H2;1H |
| InChIKey | DKJDMGBLYQJEJK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride?
The IUPAC name of pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride (CID 174730416) is pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride.
What is the SMILES notation for pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride?
The canonical SMILES for pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride is Cl.O=C(ON1CCCC1)C1CC1.
What is the InChIKey of pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride?
The InChIKey is DKJDMGBLYQJEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2.ClH/c10-8(7-3-4-7)11-9-5-1-2-6-9;/h7H,1-6H2;1H.
What are the key properties of pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride?
pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride has a molecular weight of 191.66 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl cyclopropanecarboxylate;hydrochloride is sourced from PubChem (CID 174730416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).