C11H21NO5 — CID 103178746
2-(3-methoxypropoxy)ethyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 103178746) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)ethyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | 2-(3-methoxypropoxy)ethyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 103178746 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-(3-methoxypropoxy)ethyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | COCCCOCCOC(=O)[C@@H]1C[C@H](O)CN1 |
| InChI | InChI=1S/C11H21NO5/c1-15-3-2-4-16-5-6-17-11(14)10-7-9(13)8-12-10/h9-10,12-13H,2-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | YUCHPNDZYQLWTP-UWVGGRQHSA-N |
| XLogP | -0.69 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|