C11H22N2O2 — CID 58092718
butyl (2S,4S)-4-(dimethylamino)pyrrolidine-2-carboxylate (PubChem CID 58092718) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is butyl (2S,4S)-4-(dimethylamino)pyrrolidine-2-carboxylate.
| Compound Name | butyl (2S,4S)-4-(dimethylamino)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58092718 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | butyl (2S,4S)-4-(dimethylamino)pyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1C[C@H](N(C)C)CN1 |
| InChI | InChI=1S/C11H22N2O2/c1-4-5-6-15-11(14)10-7-9(8-12-10)13(2)3/h9-10,12H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | NNQUSUAAPJMGSX-UWVGGRQHSA-N |
| XLogP | 0.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|