C12H21NO2 — CID 118312112
butyl (3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate (PubChem CID 118312112) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is butyl (3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | butyl (3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 118312112 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | butyl (3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCCCOC(=O)C1C[C@@H]2CCC[C@@H]2N1 |
| InChI | InChI=1S/C12H21NO2/c1-2-3-7-15-12(14)11-8-9-5-4-6-10(9)13-11/h9-11,13H,2-8H2,1H3/t9-,10-,11?/m0/s1 |
| InChIKey | FWZZJMASSAYCFW-QRHSGQBVSA-N |
| XLogP | 1.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|