C17H31NO2 — CID 63540162
octyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate (PubChem CID 63540162) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is octyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate.
| Compound Name | octyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 63540162 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | octyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C17H31NO2/c1-2-3-4-5-6-9-12-20-17(19)16-13-14-10-7-8-11-15(14)18-16/h14-16,18H,2-13H2,1H3 |
| InChIKey | JGCCEYISOGICLH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|