C13H21NO2 — CID 130440929
cyclobutyl (2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate (PubChem CID 130440929) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is cyclobutyl (2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate.
| Compound Name | cyclobutyl (2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 130440929 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | cyclobutyl (2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate |
| SMILES | O=C(OC1CCC1)[C@@H]1C[C@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C13H21NO2/c15-13(16-10-5-3-6-10)12-8-9-4-1-2-7-11(9)14-12/h9-12,14H,1-8H2/t9-,11-,12+/m1/s1 |
| InChIKey | CQLQNOLCFOBAOZ-JLLWLGSASA-N |
| XLogP | 2.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |