C18H30N2O4 — CID 161432755
methyl 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate (PubChem CID 161432755) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is methyl 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | methyl 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 161432755 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | methyl 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCC2N1.COC(=O)C1CC2CCCC2N1 |
| InChI | InChI=1S/2C9H15NO2/c2*1-12-9(11)8-5-6-3-2-4-7(6)10-8/h2*6-8,10H,2-5H2,1H3 |
| InChIKey | VYFVUIYLJLOFLD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |