About butyl (6R)-6-methylpiperidine-2-carboxylate chloride
butyl (6R)-6-methylpiperidine-2-carboxylate chloride (PubChem CID 53313724) has the molecular formula C11H21ClNO2-
and a molecular weight of 234.75 g/mol. Its IUPAC name is butyl (6R)-6-methylpiperidine-2-carboxylate chloride.
Molecular Properties
| Compound Name | butyl (6R)-6-methylpiperidine-2-carboxylate chloride |
| PubChem CID | 53313724 |
| Molecular Formula | C11H21ClNO2- |
| Molecular Weight | 234.75 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | butyl (6R)-6-methylpiperidine-2-carboxylate chloride |
| SMILES | CCCCOC(=O)C1CCC[C@@H](C)N1.[Cl-] |
| InChI | InChI=1S/C11H21NO2.ClH/c1-3-4-8-14-11(13)10-7-5-6-9(2)12-10;/h9-10,12H,3-8H2,1-2H3;1H/p-1/t9-,10?;/m1./s1 |
| InChIKey | KEXDWNYDFPGSCM-UVUXOWFKSA-M |
| XLogP | -1.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.75 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl (6R)-6-methylpiperidine-2-carboxylate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (6R)-6-methylpiperidine-2-carboxylate chloride?
The IUPAC name of butyl (6R)-6-methylpiperidine-2-carboxylate chloride (CID 53313724) is butyl (6R)-6-methylpiperidine-2-carboxylate chloride.
What is the SMILES notation for butyl (6R)-6-methylpiperidine-2-carboxylate chloride?
The canonical SMILES for butyl (6R)-6-methylpiperidine-2-carboxylate chloride is CCCCOC(=O)C1CCC[C@@H](C)N1.[Cl-].
What is the InChIKey of butyl (6R)-6-methylpiperidine-2-carboxylate chloride?
The InChIKey is KEXDWNYDFPGSCM-UVUXOWFKSA-M. The full InChI is InChI=1S/C11H21NO2.ClH/c1-3-4-8-14-11(13)10-7-5-6-9(2)12-10;/h9-10,12H,3-8H2,1-2H3;1H/p-1/t9-,10?;/m1./s1.
What are the key properties of butyl (6R)-6-methylpiperidine-2-carboxylate chloride?
butyl (6R)-6-methylpiperidine-2-carboxylate chloride has a molecular weight of 234.75 g/mol, XLogP of -1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (6R)-6-methylpiperidine-2-carboxylate chloride is sourced from PubChem (CID 53313724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).