C7H12N2O4 — CID 92860822
2-[[(2S,4S)-4-hydroxypyrrolidine-2-carbonyl]amino]acetic acid (PubChem CID 92860822) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-[[(2S,4S)-4-hydroxypyrrolidine-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(2S,4S)-4-hydroxypyrrolidine-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 92860822 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-[[(2S,4S)-4-hydroxypyrrolidine-2-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)[C@@H]1C[C@H](O)CN1 |
| InChI | InChI=1S/C7H12N2O4/c10-4-1-5(8-2-4)7(13)9-3-6(11)12/h4-5,8,10H,1-3H2,(H,9,13)(H,11,12)/t4-,5-/m0/s1 |
| InChIKey | WFDSWNXTPKLLOT-WHFBIAKZSA-N |
| XLogP | -2.09 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |