C12H23BN3O3 — CID 160581265
CID 160581265 (PubChem CID 160581265) has the molecular formula C12H23BN3O3 and a molecular weight of 268.15 g/mol.
| Compound Name | CID 160581265 |
|---|---|
| PubChem CID | 160581265 |
| Molecular Formula | C12H23BN3O3 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | — |
| SMILES | CCN[C@@H](CNC(=O)C1C[C@@H](O)CN1)C(=O)CC.[B] |
| InChI | InChI=1S/C12H23N3O3.B/c1-3-11(17)10(13-4-2)7-15-12(18)9-5-8(16)6-14-9;/h8-10,13-14,16H,3-7H2,1-2H3,(H,15,18);/t8-,9?,10+;/m1./s1 |
| InChIKey | UMJTXIOZMJSSSA-NKUWADJFSA-N |
| XLogP | -1.60 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|