C13H24N2O3 — CID 122145254
N-(2-cyclohexyl-2-hydroxyethyl)-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 122145254) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-(2-cyclohexyl-2-hydroxyethyl)-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-(2-cyclohexyl-2-hydroxyethyl)-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 122145254 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-(2-cyclohexyl-2-hydroxyethyl)-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | O=C(NCC(O)C1CCCCC1)C1CC(O)CN1 |
| InChI | InChI=1S/C13H24N2O3/c16-10-6-11(14-7-10)13(18)15-8-12(17)9-4-2-1-3-5-9/h9-12,14,16-17H,1-8H2,(H,15,18) |
| InChIKey | JLPPUMSQIIVSLU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |