About 5-(aminomethyl)pyrrolidin-3-ol;methanol
5-(aminomethyl)pyrrolidin-3-ol;methanol (PubChem CID 145422369) has the molecular formula C6H16N2O2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-(aminomethyl)pyrrolidin-3-ol;methanol.
Molecular Properties
| Compound Name | 5-(aminomethyl)pyrrolidin-3-ol;methanol |
| PubChem CID | 145422369 |
| Molecular Formula | C6H16N2O2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.12 |
| IUPAC Name | 5-(aminomethyl)pyrrolidin-3-ol;methanol |
| SMILES | CO.NCC1CC(O)CN1 |
| InChI | InChI=1S/C5H12N2O.CH4O/c6-2-4-1-5(8)3-7-4;1-2/h4-5,7-8H,1-3,6H2;2H,1H3 |
| InChIKey | VZZWEDHVXOZLOL-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)pyrrolidin-3-ol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)pyrrolidin-3-ol;methanol?
The IUPAC name of 5-(aminomethyl)pyrrolidin-3-ol;methanol (CID 145422369) is 5-(aminomethyl)pyrrolidin-3-ol;methanol.
What is the SMILES notation for 5-(aminomethyl)pyrrolidin-3-ol;methanol?
The canonical SMILES for 5-(aminomethyl)pyrrolidin-3-ol;methanol is CO.NCC1CC(O)CN1.
What is the InChIKey of 5-(aminomethyl)pyrrolidin-3-ol;methanol?
The InChIKey is VZZWEDHVXOZLOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O.CH4O/c6-2-4-1-5(8)3-7-4;1-2/h4-5,7-8H,1-3,6H2;2H,1H3.
What are the key properties of 5-(aminomethyl)pyrrolidin-3-ol;methanol?
5-(aminomethyl)pyrrolidin-3-ol;methanol has a molecular weight of 148.21 g/mol, XLogP of -1.72, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)pyrrolidin-3-ol;methanol is sourced from PubChem (CID 145422369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).