C17H24F3NO3 — CID 174428984
bicyclo[2.2.0]hexa-1,3,5-triene;tert-butyl formate;4-(trifluoromethyl)piperidin-4-ol (PubChem CID 174428984) has the molecular formula C17H24F3NO3 and a molecular weight of 347.38 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;tert-butyl formate;4-(trifluoromethyl)piperidin-4-ol.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;tert-butyl formate;4-(trifluoromethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 174428984 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;tert-butyl formate;4-(trifluoromethyl)piperidin-4-ol |
| SMILES | CC(C)(C)OC=O.OC1(C(F)(F)F)CCNCC1.c1cc2ccc1-2 |
| InChI | InChI=1S/C6H10F3NO.C6H4.C5H10O2/c7-6(8,9)5(11)1-3-10-4-2-5;1-2-6-4-3-5(1)6;1-5(2,3)7-4-6/h10-11H,1-4H2;1-4H;4H,1-3H3 |
| InChIKey | TUMKZNXOVJQTJY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|