C6H13F2N — CID 143607085
4,4-difluoropiperidine;methane (PubChem CID 143607085) has the molecular formula C6H13F2N and a molecular weight of 137.17 g/mol. Its IUPAC name is 4,4-difluoropiperidine;methane.
| Compound Name | 4,4-difluoropiperidine;methane |
|---|---|
| PubChem CID | 143607085 |
| Molecular Formula | C6H13F2N |
| Molecular Weight | 137.17 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 4,4-difluoropiperidine;methane |
| SMILES | C.FC1(F)CCNCC1 |
| InChI | InChI=1S/C5H9F2N.CH4/c6-5(7)1-3-8-4-2-5;/h8H,1-4H2;1H4 |
| InChIKey | DDOZZPYQBJENPM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |